C22H19N3O4 — CID 110171948
1-benzyl-6-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 110171948) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 1-benzyl-6-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-6-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110171948 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-benzyl-6-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(-c2cnc3c(c2)c(=O)[nH]c(=O)n3Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C22H19N3O4/c1-28-18-9-8-15(11-19(18)29-2)16-10-17-20(23-12-16)25(22(27)24-21(17)26)13-14-6-4-3-5-7-14/h3-12H,13H2,1-2H3,(H,24,26,27) |
| InChIKey | CLXFXTOTFHKHNO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |