C23H21N3O3 — CID 155556093
N-[5-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylacetamide (PubChem CID 155556093) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[5-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylacetamide.
| Compound Name | N-[5-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 155556093 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[5-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylacetamide |
| SMILES | COc1ccc(-c2cnc3[nH]cc(NC(=O)Cc4ccccc4)c3c2)cc1OC |
| InChI | InChI=1S/C23H21N3O3/c1-28-20-9-8-16(12-21(20)29-2)17-11-18-19(14-25-23(18)24-13-17)26-22(27)10-15-6-4-3-5-7-15/h3-9,11-14H,10H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | WVACAFMWZWKZSG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |