C16H14BrNO — CID 102454729
(4R)-4-(bromomethyl)-4-methyl-2-phenyl-3,1-benzoxazine (PubChem CID 102454729) has the molecular formula C16H14BrNO and a molecular weight of 316.20 g/mol. Its IUPAC name is (4R)-4-(bromomethyl)-4-methyl-2-phenyl-3,1-benzoxazine.
| Compound Name | (4R)-4-(bromomethyl)-4-methyl-2-phenyl-3,1-benzoxazine |
|---|---|
| PubChem CID | 102454729 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (4R)-4-(bromomethyl)-4-methyl-2-phenyl-3,1-benzoxazine |
| SMILES | C[C@@]1(CBr)OC(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C16H14BrNO/c1-16(11-17)13-9-5-6-10-14(13)18-15(19-16)12-7-3-2-4-8-12/h2-10H,11H2,1H3/t16-/m0/s1 |
| InChIKey | GNHLRCXQTJHLDV-INIZCTEOSA-N |
| XLogP | 4.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|