C17H13F3N2O3 — CID 122377016
4-methyl-2-(4-nitrophenyl)-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine (PubChem CID 122377016) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 4-methyl-2-(4-nitrophenyl)-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine.
| Compound Name | 4-methyl-2-(4-nitrophenyl)-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine |
|---|---|
| PubChem CID | 122377016 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-methyl-2-(4-nitrophenyl)-4-(2,2,2-trifluoroethyl)-3,1-benzoxazine |
| SMILES | CC1(CC(F)(F)F)OC(c2ccc([N+](=O)[O-])cc2)=Nc2ccccc21 |
| InChI | InChI=1S/C17H13F3N2O3/c1-16(10-17(18,19)20)13-4-2-3-5-14(13)21-15(25-16)11-6-8-12(9-7-11)22(23)24/h2-9H,10H2,1H3 |
| InChIKey | PYUDRRKMFPAJIL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|