C17H10F6N2O4 — CID 12540831
2-(4-nitrophenyl)-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-dioxazine (PubChem CID 12540831) has the molecular formula C17H10F6N2O4 and a molecular weight of 420.27 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-dioxazine.
| Compound Name | 2-(4-nitrophenyl)-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-dioxazine |
|---|---|
| PubChem CID | 12540831 |
| Molecular Formula | C17H10F6N2O4 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-(4-nitrophenyl)-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-dioxazine |
| SMILES | O=[N+]([O-])c1ccc(C2OC(c3ccccc3)=NC(C(F)(F)F)(C(F)(F)F)O2)cc1 |
| InChI | InChI=1S/C17H10F6N2O4/c18-16(19,20)15(17(21,22)23)24-13(10-4-2-1-3-5-10)28-14(29-15)11-6-8-12(9-7-11)25(26)27/h1-9,14H |
| InChIKey | ZJWSQWOEJMZLME-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|