C25H24N4O3 — CID 13117641
4-[1-(4-nitrophenyl)-2,5-diphenyl-4,5-dihydroimidazol-4-yl]morpholine (PubChem CID 13117641) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-[1-(4-nitrophenyl)-2,5-diphenyl-4,5-dihydroimidazol-4-yl]morpholine.
| Compound Name | 4-[1-(4-nitrophenyl)-2,5-diphenyl-4,5-dihydroimidazol-4-yl]morpholine |
|---|---|
| PubChem CID | 13117641 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-[1-(4-nitrophenyl)-2,5-diphenyl-4,5-dihydroimidazol-4-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(N2C(c3ccccc3)=NC(N3CCOCC3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N4O3/c30-29(31)22-13-11-21(12-14-22)28-23(19-7-3-1-4-8-19)25(27-15-17-32-18-16-27)26-24(28)20-9-5-2-6-10-20/h1-14,23,25H,15-18H2 |
| InChIKey | ZLOQKRXCSYGWMT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|