C50H41N5O2 — CID 71653783
(4S,5S)-1-(4-methylphenyl)-2-[3-[(4S,5S)-1-(4-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-2-yl]-5-nitrophenyl]-4,5-diphenyl-4,5-dihydroimidazole (PubChem CID 71653783) has the molecular formula C50H41N5O2 and a molecular weight of 743.91 g/mol. Its IUPAC name is (4S,5S)-1-(4-methylphenyl)-2-[3-[(4S,5S)-1-(4-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-2-yl]-5-nitrophenyl]-4,5-diphenyl-4,5-dihydroimidazole.
| Compound Name | (4S,5S)-1-(4-methylphenyl)-2-[3-[(4S,5S)-1-(4-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-2-yl]-5-nitrophenyl]-4,5-diphenyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 71653783 |
| Molecular Formula | C50H41N5O2 |
| Molecular Weight | 743.91 g/mol |
| Exact Mass | 743.33 |
| IUPAC Name | (4S,5S)-1-(4-methylphenyl)-2-[3-[(4S,5S)-1-(4-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-2-yl]-5-nitrophenyl]-4,5-diphenyl-4,5-dihydroimidazole |
| SMILES | Cc1ccc(N2C(c3cc(C4=N[C@@H](c5ccccc5)[C@H](c5ccccc5)N4c4ccc(C)cc4)cc([N+](=O)[O-])c3)=N[C@@H](c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C50H41N5O2/c1-34-23-27-42(28-24-34)53-47(38-19-11-5-12-20-38)45(36-15-7-3-8-16-36)51-49(53)40-31-41(33-44(32-40)55(56)57)50-52-46(37-17-9-4-10-18-37)48(39-21-13-6-14-22-39)54(50)43-29-25-35(2)26-30-43/h3-33,45-48H,1-2H3/t45-,46-,47-,48-/m0/s1 |
| InChIKey | DXBRBPUEQSZIIS-KVXOYYPDSA-N |
| XLogP | 11.71 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.91 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|