C21H15N5O4 — CID 135062809
4-(4-methylphenyl)-3,5-bis(3-nitrophenyl)-1,2,4-triazole (PubChem CID 135062809) has the molecular formula C21H15N5O4 and a molecular weight of 401.38 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3,5-bis(3-nitrophenyl)-1,2,4-triazole.
| Compound Name | 4-(4-methylphenyl)-3,5-bis(3-nitrophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 135062809 |
| Molecular Formula | C21H15N5O4 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-(4-methylphenyl)-3,5-bis(3-nitrophenyl)-1,2,4-triazole |
| SMILES | Cc1ccc(-n2c(-c3cccc([N+](=O)[O-])c3)nnc2-c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H15N5O4/c1-14-8-10-17(11-9-14)24-20(15-4-2-6-18(12-15)25(27)28)22-23-21(24)16-5-3-7-19(13-16)26(29)30/h2-13H,1H3 |
| InChIKey | CJGNSACAFUDYOL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|