C22H18N2O3 — CID 95363827
(1S)-2-(4-methylphenyl)-1-(3-nitrophenyl)-1,4-dihydroisoquinolin-3-one (PubChem CID 95363827) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is (1S)-2-(4-methylphenyl)-1-(3-nitrophenyl)-1,4-dihydroisoquinolin-3-one.
| Compound Name | (1S)-2-(4-methylphenyl)-1-(3-nitrophenyl)-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 95363827 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (1S)-2-(4-methylphenyl)-1-(3-nitrophenyl)-1,4-dihydroisoquinolin-3-one |
| SMILES | Cc1ccc(N2C(=O)Cc3ccccc3[C@@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H18N2O3/c1-15-9-11-18(12-10-15)23-21(25)14-16-5-2-3-8-20(16)22(23)17-6-4-7-19(13-17)24(26)27/h2-13,22H,14H2,1H3/t22-/m0/s1 |
| InChIKey | QTWODZHSKJWAGO-QFIPXVFZSA-N |
| XLogP | 4.58 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|