C20H16N2O2 — CID 57073037
1-[4-(3-nitrophenyl)-1,4-dihydronaphthalen-2-yl]pyrrole (PubChem CID 57073037) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[4-(3-nitrophenyl)-1,4-dihydronaphthalen-2-yl]pyrrole.
| Compound Name | 1-[4-(3-nitrophenyl)-1,4-dihydronaphthalen-2-yl]pyrrole |
|---|---|
| PubChem CID | 57073037 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[4-(3-nitrophenyl)-1,4-dihydronaphthalen-2-yl]pyrrole |
| SMILES | O=[N+]([O-])c1cccc(C2C=C(n3cccc3)Cc3ccccc32)c1 |
| InChI | InChI=1S/C20H16N2O2/c23-22(24)17-8-5-7-16(12-17)20-14-18(21-10-3-4-11-21)13-15-6-1-2-9-19(15)20/h1-12,14,20H,13H2 |
| InChIKey | NGWQRDXLRCZCSX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|