C19H11F3N4O3 — CID 154270894
1-(4-nitrophenyl)-2-phenyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 154270894) has the molecular formula C19H11F3N4O3 and a molecular weight of 400.32 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2-phenyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 1-(4-nitrophenyl)-2-phenyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 154270894 |
| Molecular Formula | C19H11F3N4O3 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1-(4-nitrophenyl)-2-phenyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(C(F)(F)F)nc2cc(-c3ccccc3)n(-c3ccc([N+](=O)[O-])cc3)n12 |
| InChI | InChI=1S/C19H11F3N4O3/c20-19(21,22)16-11-18(27)25-17(23-16)10-15(12-4-2-1-3-5-12)24(25)13-6-8-14(9-7-13)26(28)29/h1-11H |
| InChIKey | ZENRKRXEBVRBKC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|