C18H15ClN2O — CID 163288493
3-[2-(4-chlorophenyl)-4-methyl-3,1-benzoxazin-4-yl]propanenitrile (PubChem CID 163288493) has the molecular formula C18H15ClN2O and a molecular weight of 310.78 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-4-methyl-3,1-benzoxazin-4-yl]propanenitrile.
| Compound Name | 3-[2-(4-chlorophenyl)-4-methyl-3,1-benzoxazin-4-yl]propanenitrile |
|---|---|
| PubChem CID | 163288493 |
| Molecular Formula | C18H15ClN2O |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-4-methyl-3,1-benzoxazin-4-yl]propanenitrile |
| SMILES | CC1(CCC#N)OC(c2ccc(Cl)cc2)=Nc2ccccc21 |
| InChI | InChI=1S/C18H15ClN2O/c1-18(11-4-12-20)15-5-2-3-6-16(15)21-17(22-18)13-7-9-14(19)10-8-13/h2-3,5-10H,4,11H2,1H3 |
| InChIKey | GBARDXYEMCYRQB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |