C17H13BrF3NO — CID 146166655
4-(bromomethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine (PubChem CID 146166655) has the molecular formula C17H13BrF3NO and a molecular weight of 384.20 g/mol. Its IUPAC name is 4-(bromomethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine.
| Compound Name | 4-(bromomethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine |
|---|---|
| PubChem CID | 146166655 |
| Molecular Formula | C17H13BrF3NO |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 4-(bromomethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine |
| SMILES | CC1(CBr)OC(c2ccc(C(F)(F)F)cc2)=Nc2ccccc21 |
| InChI | InChI=1S/C17H13BrF3NO/c1-16(10-18)13-4-2-3-5-14(13)22-15(23-16)11-6-8-12(9-7-11)17(19,20)21/h2-9H,10H2,1H3 |
| InChIKey | NGRLDECIOQBCHL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|