C24H21NO2 — CID 162416101
4-(2,4-diphenyl-3,1-benzoxazin-4-yl)butan-2-one (PubChem CID 162416101) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-(2,4-diphenyl-3,1-benzoxazin-4-yl)butan-2-one.
| Compound Name | 4-(2,4-diphenyl-3,1-benzoxazin-4-yl)butan-2-one |
|---|---|
| PubChem CID | 162416101 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-(2,4-diphenyl-3,1-benzoxazin-4-yl)butan-2-one |
| SMILES | CC(=O)CCC1(c2ccccc2)OC(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C24H21NO2/c1-18(26)16-17-24(20-12-6-3-7-13-20)21-14-8-9-15-22(21)25-23(27-24)19-10-4-2-5-11-19/h2-15H,16-17H2,1H3 |
| InChIKey | SMNJZNISILIMDH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |