C19H18BrNO — CID 134946305
(4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] (PubChem CID 134946305) has the molecular formula C19H18BrNO and a molecular weight of 356.26 g/mol. Its IUPAC name is (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane].
| Compound Name | (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 134946305 |
| Molecular Formula | C19H18BrNO |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] |
| SMILES | BrC1CCCC[C@]12OC(c1ccccc1)=Nc1ccccc12 |
| InChI | InChI=1S/C19H18BrNO/c20-17-12-6-7-13-19(17)15-10-4-5-11-16(15)21-18(22-19)14-8-2-1-3-9-14/h1-5,8-11,17H,6-7,12-13H2/t17?,19-/m1/s1 |
| InChIKey | FNBWBTHFBZTJME-WHCXFUJUSA-N |
| XLogP | 5.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|