About (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane]
(4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] (PubChem CID 134946305) has the molecular formula C19H18BrNO
and a molecular weight of 356.26 g/mol. Its IUPAC name is (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane].
Molecular Properties
| Compound Name | (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] |
| PubChem CID | 134946305 |
| Molecular Formula | C19H18BrNO |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] |
| SMILES | BrC1CCCC[C@]12OC(c1ccccc1)=Nc1ccccc12 |
| InChI | InChI=1S/C19H18BrNO/c20-17-12-6-7-13-19(17)15-10-4-5-11-16(15)21-18(22-19)14-8-2-1-3-9-14/h1-5,8-11,17H,6-7,12-13H2/t17?,19-/m1/s1 |
| InChIKey | FNBWBTHFBZTJME-WHCXFUJUSA-N |
| XLogP | 5.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane]?
The IUPAC name of (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] (CID 134946305) is (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane].
What is the SMILES notation for (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane]?
The canonical SMILES for (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] is BrC1CCCC[C@]12OC(c1ccccc1)=Nc1ccccc12.
What is the InChIKey of (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane]?
The InChIKey is FNBWBTHFBZTJME-WHCXFUJUSA-N. The full InChI is InChI=1S/C19H18BrNO/c20-17-12-6-7-13-19(17)15-10-4-5-11-16(15)21-18(22-19)14-8-2-1-3-9-14/h1-5,8-11,17H,6-7,12-13H2/t17?,19-/m1/s1.
What are the key properties of (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane]?
(4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] has a molecular weight of 356.26 g/mol, XLogP of 5.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2'-bromo-2-phenylspiro[3,1-benzoxazine-4,1'-cyclohexane] is sourced from PubChem (CID 134946305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).