C19H17NO4 — CID 102476767
5-(3-oxobutyl)-3,5-diphenyl-1,3-oxazolidine-2,4-dione (PubChem CID 102476767) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-(3-oxobutyl)-3,5-diphenyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(3-oxobutyl)-3,5-diphenyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 102476767 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-(3-oxobutyl)-3,5-diphenyl-1,3-oxazolidine-2,4-dione |
| SMILES | CC(=O)CCC1(c2ccccc2)OC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17NO4/c1-14(21)12-13-19(15-8-4-2-5-9-15)17(22)20(18(23)24-19)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3 |
| InChIKey | CJBAKTWFDUJTLN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |