C19H20N2O3Si — CID 42611516
trimethyl-[[2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-yl]methyl]silane (PubChem CID 42611516) has the molecular formula C19H20N2O3Si and a molecular weight of 352.47 g/mol. Its IUPAC name is trimethyl-[[2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-yl]methyl]silane.
| Compound Name | trimethyl-[[2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-yl]methyl]silane |
|---|---|
| PubChem CID | 42611516 |
| Molecular Formula | C19H20N2O3Si |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | trimethyl-[[2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-yl]methyl]silane |
| SMILES | C[Si](C)(C)Cc1oc(-c2ccc([N+](=O)[O-])cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3Si/c1-25(2,3)13-17-18(14-7-5-4-6-8-14)20-19(24-17)15-9-11-16(12-10-15)21(22)23/h4-12H,13H2,1-3H3 |
| InChIKey | BXPVQFWJYYNOFK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|