C15H12N2O3 — CID 95911692
7-ethyl-5-nitro-2-phenyl-1,3-benzoxazole (PubChem CID 95911692) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 7-ethyl-5-nitro-2-phenyl-1,3-benzoxazole.
| Compound Name | 7-ethyl-5-nitro-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 95911692 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 7-ethyl-5-nitro-2-phenyl-1,3-benzoxazole |
| SMILES | CCc1cc([N+](=O)[O-])cc2nc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C15H12N2O3/c1-2-10-8-12(17(18)19)9-13-14(10)20-15(16-13)11-6-4-3-5-7-11/h3-9H,2H2,1H3 |
| InChIKey | OHNVXCFPQAHWRO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|