C15H11ClN2O3 — CID 91673426
2-(2-chlorophenyl)-7-ethyl-5-nitro-1,3-benzoxazole (PubChem CID 91673426) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-7-ethyl-5-nitro-1,3-benzoxazole.
| Compound Name | 2-(2-chlorophenyl)-7-ethyl-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 91673426 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(2-chlorophenyl)-7-ethyl-5-nitro-1,3-benzoxazole |
| SMILES | CCc1cc([N+](=O)[O-])cc2nc(-c3ccccc3Cl)oc12 |
| InChI | InChI=1S/C15H11ClN2O3/c1-2-9-7-10(18(19)20)8-13-14(9)21-15(17-13)11-5-3-4-6-12(11)16/h3-8H,2H2,1H3 |
| InChIKey | SDJVJMZBGJVLRC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|