C18H11ClN2O3 — CID 95910763
2-(5-chloronaphthalen-1-yl)-7-methyl-5-nitro-1,3-benzoxazole (PubChem CID 95910763) has the molecular formula C18H11ClN2O3 and a molecular weight of 338.75 g/mol. Its IUPAC name is 2-(5-chloronaphthalen-1-yl)-7-methyl-5-nitro-1,3-benzoxazole.
| Compound Name | 2-(5-chloronaphthalen-1-yl)-7-methyl-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 95910763 |
| Molecular Formula | C18H11ClN2O3 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-(5-chloronaphthalen-1-yl)-7-methyl-5-nitro-1,3-benzoxazole |
| SMILES | Cc1cc([N+](=O)[O-])cc2nc(-c3cccc4c(Cl)cccc34)oc12 |
| InChI | InChI=1S/C18H11ClN2O3/c1-10-8-11(21(22)23)9-16-17(10)24-18(20-16)14-6-2-5-13-12(14)4-3-7-15(13)19/h2-9H,1H3 |
| InChIKey | MHXHLVIMYVNTLK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|