C14H8Cl2N2O3 — CID 91673835
2-(2,3-dichlorophenyl)-7-methyl-5-nitro-1,3-benzoxazole (PubChem CID 91673835) has the molecular formula C14H8Cl2N2O3 and a molecular weight of 323.14 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-7-methyl-5-nitro-1,3-benzoxazole.
| Compound Name | 2-(2,3-dichlorophenyl)-7-methyl-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 91673835 |
| Molecular Formula | C14H8Cl2N2O3 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-7-methyl-5-nitro-1,3-benzoxazole |
| SMILES | Cc1cc([N+](=O)[O-])cc2nc(-c3cccc(Cl)c3Cl)oc12 |
| InChI | InChI=1S/C14H8Cl2N2O3/c1-7-5-8(18(19)20)6-11-13(7)21-14(17-11)9-3-2-4-10(15)12(9)16/h2-6H,1H3 |
| InChIKey | SOBZPZUIYKTCMM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|