C15H13BrN3O3+ — CID 91673471
2-(5-bromo-1-methylpyridin-1-ium-3-yl)-7-ethyl-5-nitro-1,3-benzoxazole (PubChem CID 91673471) has the molecular formula C15H13BrN3O3+ and a molecular weight of 363.19 g/mol. Its IUPAC name is 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-7-ethyl-5-nitro-1,3-benzoxazole.
| Compound Name | 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-7-ethyl-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 91673471 |
| Molecular Formula | C15H13BrN3O3+ |
| Molecular Weight | 363.19 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-7-ethyl-5-nitro-1,3-benzoxazole |
| SMILES | CCc1cc([N+](=O)[O-])cc2nc(-c3cc(Br)c[n+](C)c3)oc12 |
| InChI | InChI=1S/C15H13BrN3O3/c1-3-9-5-12(19(20)21)6-13-14(9)22-15(17-13)10-4-11(16)8-18(2)7-10/h4-8H,3H2,1-2H3/q+1 |
| InChIKey | BDZDVRDOLIPEPC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|