C29H29IrN2- — CID 140756565
7-(2,6-dimethylphenyl)-1,11-dimethyl-6-phenyl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene;iridium (PubChem CID 140756565) has the molecular formula C29H29IrN2- and a molecular weight of 597.78 g/mol. Its IUPAC name is 7-(2,6-dimethylphenyl)-1,11-dimethyl-6-phenyl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene;iridium.
| Compound Name | 7-(2,6-dimethylphenyl)-1,11-dimethyl-6-phenyl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene;iridium |
|---|---|
| PubChem CID | 140756565 |
| Molecular Formula | C29H29IrN2- |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 7-(2,6-dimethylphenyl)-1,11-dimethyl-6-phenyl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene;iridium |
| SMILES | Cc1cccc(C)c1-n1c(-c2[c-]cccc2)nc2cc3c(cc21)C1(C)CCC3(C)CC1.[Ir] |
| InChI | InChI=1S/C29H29N2.Ir/c1-19-9-8-10-20(2)26(19)31-25-18-23-22(28(3)13-15-29(23,4)16-14-28)17-24(25)30-27(31)21-11-6-5-7-12-21;/h5-11,17-18H,13-16H2,1-4H3;/q-1; |
| InChIKey | JAWUZNCZIKGSHZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|