C22H23IrN2- — CID 140756590
iridium;6-phenyl-7-propan-2-yl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene (PubChem CID 140756590) has the molecular formula C22H23IrN2- and a molecular weight of 507.66 g/mol. Its IUPAC name is iridium;6-phenyl-7-propan-2-yl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene.
| Compound Name | iridium;6-phenyl-7-propan-2-yl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene |
|---|---|
| PubChem CID | 140756590 |
| Molecular Formula | C22H23IrN2- |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | iridium;6-phenyl-7-propan-2-yl-5,7-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),5,9-tetraene |
| SMILES | CC(C)n1c(-c2[c-]cccc2)nc2cc3c(cc21)C1CCC3CC1.[Ir] |
| InChI | InChI=1S/C22H23N2.Ir/c1-14(2)24-21-13-19-16-10-8-15(9-11-16)18(19)12-20(21)23-22(24)17-6-4-3-5-7-17;/h3-6,12-16H,8-11H2,1-2H3;/q-1; |
| InChIKey | VTAYQHRMHLQSGC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|