C19H24IrNSi- — CID 140739402
(4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium (PubChem CID 140739402) has the molecular formula C19H24IrNSi- and a molecular weight of 486.71 g/mol. Its IUPAC name is (4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium.
| Compound Name | (4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium |
|---|---|
| PubChem CID | 140739402 |
| Molecular Formula | C19H24IrNSi- |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1C1CCCC1.[Ir] |
| InChI | InChI=1S/C19H24NSi.Ir/c1-21(2,3)19-14-20-18(16-11-5-4-6-12-16)13-17(19)15-9-7-8-10-15;/h4-6,11,13-15H,7-10H2,1-3H3;/q-1; |
| InChIKey | XQVPEMUWLIHHFR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|