C55H54IrN2OSi-2 — CID 166575749
4-cyclohexyl-2-[6-(4-phenylphenyl)-2H-dibenzofuran-2-id-3-yl]pyridine;[4-(1-deuteriocyclohexyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166575749) has the molecular formula C55H54IrN2OSi-2 and a molecular weight of 980.36 g/mol. Its IUPAC name is 4-cyclohexyl-2-[6-(4-phenylphenyl)-2H-dibenzofuran-2-id-3-yl]pyridine;[4-(1-deuteriocyclohexyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 4-cyclohexyl-2-[6-(4-phenylphenyl)-2H-dibenzofuran-2-id-3-yl]pyridine;[4-(1-deuteriocyclohexyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166575749 |
| Molecular Formula | C55H54IrN2OSi-2 |
| Molecular Weight | 980.36 g/mol |
| Exact Mass | 980.37 |
| IUPAC Name | 4-cyclohexyl-2-[6-(4-phenylphenyl)-2H-dibenzofuran-2-id-3-yl]pyridine;[4-(1-deuteriocyclohexyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | [2H]C1(c2cc(-c3[c-]cccc3)ncc2[Si](C)(C)C)CCCCC1.[Ir].[c-]1cc2c(cc1-c1cc(C3CCCCC3)ccn1)oc1c(-c3ccc(-c4ccccc4)cc3)cccc12 |
| InChI | InChI=1S/C35H28NO.C20H26NSi.Ir/c1-3-8-24(9-4-1)26-14-16-27(17-15-26)30-12-7-13-32-31-19-18-29(23-34(31)37-35(30)32)33-22-28(20-21-36-33)25-10-5-2-6-11-25;1-22(2,3)20-15-21-19(17-12-8-5-9-13-17)14-18(20)16-10-6-4-7-11-16;/h1,3-4,7-9,12-17,19-23,25H,2,5-6,10-11H2;5,8-9,12,14-16H,4,6-7,10-11H2,1-3H3;/q2*-1;/i;16D; |
| InChIKey | NCFFPQNTASLJCW-IAWZRPOVSA-N |
| XLogP | 14.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.36 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|