C41H43IrN3OSi-2 — CID 155612256
3-[4-(cyclopentylmethyl)-2-pyridinyl]-2H-[1]benzofuro[2,3-b]pyridin-2-ide;(4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium (PubChem CID 155612256) has the molecular formula C41H43IrN3OSi-2 and a molecular weight of 814.12 g/mol. Its IUPAC name is 3-[4-(cyclopentylmethyl)-2-pyridinyl]-2H-[1]benzofuro[2,3-b]pyridin-2-ide;(4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium.
| Compound Name | 3-[4-(cyclopentylmethyl)-2-pyridinyl]-2H-[1]benzofuro[2,3-b]pyridin-2-ide;(4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium |
|---|---|
| PubChem CID | 155612256 |
| Molecular Formula | C41H43IrN3OSi-2 |
| Molecular Weight | 814.12 g/mol |
| Exact Mass | 814.28 |
| IUPAC Name | 3-[4-(cyclopentylmethyl)-2-pyridinyl]-2H-[1]benzofuro[2,3-b]pyridin-2-ide;(4-cyclopentyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1C1CCCC1.[Ir].[c-]1nc2oc3ccccc3c2cc1-c1cc(CC2CCCC2)ccn1 |
| InChI | InChI=1S/C22H19N2O.C19H24NSi.Ir/c1-2-6-15(5-1)11-16-9-10-23-20(12-16)17-13-19-18-7-3-4-8-21(18)25-22(19)24-14-17;1-21(2,3)19-14-20-18(16-11-5-4-6-12-16)13-17(19)15-9-7-8-10-15;/h3-4,7-10,12-13,15H,1-2,5-6,11H2;4-6,11,13-15H,7-10H2,1-3H3;/q2*-1; |
| InChIKey | GBHSULVFXZCFAP-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.12 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|