C57H49IrN3SSi-2 — CID 156659225
(4-cyclohexyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium;2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole (PubChem CID 156659225) has the molecular formula C57H49IrN3SSi-2 and a molecular weight of 1028.41 g/mol. Its IUPAC name is (4-cyclohexyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium;2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole.
| Compound Name | (4-cyclohexyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium;2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole |
|---|---|
| PubChem CID | 156659225 |
| Molecular Formula | C57H49IrN3SSi-2 |
| Molecular Weight | 1028.41 g/mol |
| Exact Mass | 1028.31 |
| IUPAC Name | (4-cyclohexyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium;2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1C1CCCCC1.[Ir].[c-]1ccc2c(sc3cc(-c4ccccc4)ccc32)c1-c1nc2ccccc2n1-c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C37H23N2S.C20H26NSi.Ir/c1-3-12-25(13-4-1)27-22-23-29-30-17-11-18-31(36(30)40-35(29)24-27)37-38-32-19-8-10-21-34(32)39(37)33-20-9-7-16-28(33)26-14-5-2-6-15-26;1-22(2,3)20-15-21-19(17-12-8-5-9-13-17)14-18(20)16-10-6-4-7-11-16;/h1-17,19-24H;5,8-9,12,14-16H,4,6-7,10-11H2,1-3H3;/q2*-1; |
| InChIKey | SIQSCMYKERAQFT-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.41 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|