C34H37IrN2- — CID 58175683
1-[2,6-dicyclopentyl-4-(4-propan-2-ylphenyl)phenyl]-2-phenylimidazole;iridium (PubChem CID 58175683) has the molecular formula C34H37IrN2- and a molecular weight of 665.90 g/mol. Its IUPAC name is 1-[2,6-dicyclopentyl-4-(4-propan-2-ylphenyl)phenyl]-2-phenylimidazole;iridium.
| Compound Name | 1-[2,6-dicyclopentyl-4-(4-propan-2-ylphenyl)phenyl]-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 58175683 |
| Molecular Formula | C34H37IrN2- |
| Molecular Weight | 665.90 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | 1-[2,6-dicyclopentyl-4-(4-propan-2-ylphenyl)phenyl]-2-phenylimidazole;iridium |
| SMILES | CC(C)c1ccc(-c2cc(C3CCCC3)c(-n3ccnc3-c3[c-]cccc3)c(C3CCCC3)c2)cc1.[Ir] |
| InChI | InChI=1S/C34H37N2.Ir/c1-24(2)25-16-18-26(19-17-25)30-22-31(27-10-6-7-11-27)33(32(23-30)28-12-8-9-13-28)36-21-20-35-34(36)29-14-4-3-5-15-29;/h3-5,14,16-24,27-28H,6-13H2,1-2H3;/q-1; |
| InChIKey | XNZFUPZTMRIZGF-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.90 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|