C31H31IrN2- — CID 58175627
1-(2,6-dicyclopentyl-3-phenylphenyl)-2-phenylimidazole;iridium (PubChem CID 58175627) has the molecular formula C31H31IrN2- and a molecular weight of 623.82 g/mol. Its IUPAC name is 1-(2,6-dicyclopentyl-3-phenylphenyl)-2-phenylimidazole;iridium.
| Compound Name | 1-(2,6-dicyclopentyl-3-phenylphenyl)-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 58175627 |
| Molecular Formula | C31H31IrN2- |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | 1-(2,6-dicyclopentyl-3-phenylphenyl)-2-phenylimidazole;iridium |
| SMILES | [Ir].[c-]1ccccc1-c1nccn1-c1c(C2CCCC2)ccc(-c2ccccc2)c1C1CCCC1 |
| InChI | InChI=1S/C31H31N2.Ir/c1-3-11-23(12-4-1)27-19-20-28(24-13-7-8-14-24)30(29(27)25-15-9-10-16-25)33-22-21-32-31(33)26-17-5-2-6-18-26;/h1-6,11-12,17,19-22,24-25H,7-10,13-16H2;/q-1; |
| InChIKey | CFULOZIUCWLCBX-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|