C16H19IrN2- — CID 58162897
1-cyclohexyl-5-methyl-2-phenylimidazole;iridium (PubChem CID 58162897) has the molecular formula C16H19IrN2- and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-cyclohexyl-5-methyl-2-phenylimidazole;iridium.
| Compound Name | 1-cyclohexyl-5-methyl-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 58162897 |
| Molecular Formula | C16H19IrN2- |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-cyclohexyl-5-methyl-2-phenylimidazole;iridium |
| SMILES | Cc1cnc(-c2[c-]cccc2)n1C1CCCCC1.[Ir] |
| InChI | InChI=1S/C16H19N2.Ir/c1-13-12-17-16(14-8-4-2-5-9-14)18(13)15-10-6-3-7-11-15;/h2,4-5,8,12,15H,3,6-7,10-11H2,1H3;/q-1; |
| InChIKey | QMJPBJNZJCPRGH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|