C21H23IrN4O2- — CID 58426457
4-cyclohexyl-3-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426457) has the molecular formula C21H23IrN4O2- and a molecular weight of 555.66 g/mol. Its IUPAC name is 4-cyclohexyl-3-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 4-cyclohexyl-3-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426457 |
| Molecular Formula | C21H23IrN4O2- |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 4-cyclohexyl-3-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | Cc1nnc(-c2[c-]cccc2)n1C1CCCCC1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C15H18N3.C6H5NO2.Ir/c1-12-16-17-15(13-8-4-2-5-9-13)18(12)14-10-6-3-7-11-14;8-6(9)5-3-1-2-4-7-5;/h2,4-5,8,14H,3,6-7,10-11H2,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | RBEKRQGORKNTRF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|