C25H23IrN2O2- — CID 162460303
iridium;2-phenyl-3-(2,4,6-trimethylphenyl)-3H-pyrrole;pyridine-2-carboxylic acid (PubChem CID 162460303) has the molecular formula C25H23IrN2O2- and a molecular weight of 575.69 g/mol. Its IUPAC name is iridium;2-phenyl-3-(2,4,6-trimethylphenyl)-3H-pyrrole;pyridine-2-carboxylic acid.
| Compound Name | iridium;2-phenyl-3-(2,4,6-trimethylphenyl)-3H-pyrrole;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 162460303 |
| Molecular Formula | C25H23IrN2O2- |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | iridium;2-phenyl-3-(2,4,6-trimethylphenyl)-3H-pyrrole;pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C)c(C2C=CN=C2c2[c-]cccc2)c(C)c1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C19H18N.C6H5NO2.Ir/c1-13-11-14(2)18(15(3)12-13)17-9-10-20-19(17)16-7-5-4-6-8-16;8-6(9)5-3-1-2-4-7-5;/h4-7,9-12,17H,1-3H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | QBNZWTNYZJFCOG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|