C49H41IrN3-2 — CID 170539613
3-[3-(4-cyclohexylphenyl)benzene-6-id-1-yl]isoquinoline;iridium;1-methyl-2-phenyl-5-(4-phenylphenyl)imidazole (PubChem CID 170539613) has the molecular formula C49H41IrN3-2 and a molecular weight of 864.11 g/mol. Its IUPAC name is 3-[3-(4-cyclohexylphenyl)benzene-6-id-1-yl]isoquinoline;iridium;1-methyl-2-phenyl-5-(4-phenylphenyl)imidazole.
| Compound Name | 3-[3-(4-cyclohexylphenyl)benzene-6-id-1-yl]isoquinoline;iridium;1-methyl-2-phenyl-5-(4-phenylphenyl)imidazole |
|---|---|
| PubChem CID | 170539613 |
| Molecular Formula | C49H41IrN3-2 |
| Molecular Weight | 864.11 g/mol |
| Exact Mass | 864.29 |
| IUPAC Name | 3-[3-(4-cyclohexylphenyl)benzene-6-id-1-yl]isoquinoline;iridium;1-methyl-2-phenyl-5-(4-phenylphenyl)imidazole |
| SMILES | Cn1c(-c2ccc(-c3ccccc3)cc2)cnc1-c1[c-]cccc1.[Ir].[c-]1ccc(-c2ccc(C3CCCCC3)cc2)cc1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C27H24N.C22H17N2.Ir/c1-2-7-20(8-3-1)21-13-15-22(16-14-21)23-11-6-12-25(17-23)27-18-24-9-4-5-10-26(24)19-28-27;1-24-21(16-23-22(24)20-10-6-3-7-11-20)19-14-12-18(13-15-19)17-8-4-2-5-9-17;/h4-6,9-11,13-20H,1-3,7-8H2;2-10,12-16H,1H3;/q2*-1; |
| InChIKey | KDUSOSAUEVZUJW-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.11 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|