C60H39IrN4- — CID 140786374
3-[3-[4-(3,5-diphenylphenyl)-6-[3-phenyl-5-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]benzene-6-id-1-yl]isoquinoline;iridium (PubChem CID 140786374) has the molecular formula C60H39IrN4- and a molecular weight of 1008.22 g/mol. Its IUPAC name is 3-[3-[4-(3,5-diphenylphenyl)-6-[3-phenyl-5-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]benzene-6-id-1-yl]isoquinoline;iridium.
| Compound Name | 3-[3-[4-(3,5-diphenylphenyl)-6-[3-phenyl-5-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]benzene-6-id-1-yl]isoquinoline;iridium |
|---|---|
| PubChem CID | 140786374 |
| Molecular Formula | C60H39IrN4- |
| Molecular Weight | 1008.22 g/mol |
| Exact Mass | 1008.28 |
| IUPAC Name | 3-[3-[4-(3,5-diphenylphenyl)-6-[3-phenyl-5-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]benzene-6-id-1-yl]isoquinoline;iridium |
| SMILES | [Ir].[c-]1ccc(-c2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)nc(-c3cc(-c4ccccc4)cc(-c4ccccc4-c4ccccc4)c3)n2)cc1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C60H39N4.Ir/c1-5-18-41(19-6-1)49-33-50(42-20-7-2-8-21-42)36-53(35-49)59-62-58(47-29-17-28-46(32-47)57-39-45-26-13-14-27-48(45)40-61-57)63-60(64-59)54-37-51(43-22-9-3-10-23-43)34-52(38-54)56-31-16-15-30-55(56)44-24-11-4-12-25-44;/h1-27,29-40H;/q-1; |
| InChIKey | PFUIFAIXQMRGGB-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.22 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|