C20H18IrN3- — CID 155646358
iridium;5-methyl-2-phenyl-1-(2,4,6-trimethylphenyl)imidazole-4-carbonitrile (PubChem CID 155646358) has the molecular formula C20H18IrN3- and a molecular weight of 492.60 g/mol. Its IUPAC name is iridium;5-methyl-2-phenyl-1-(2,4,6-trimethylphenyl)imidazole-4-carbonitrile.
| Compound Name | iridium;5-methyl-2-phenyl-1-(2,4,6-trimethylphenyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 155646358 |
| Molecular Formula | C20H18IrN3- |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | iridium;5-methyl-2-phenyl-1-(2,4,6-trimethylphenyl)imidazole-4-carbonitrile |
| SMILES | Cc1cc(C)c(-n2c(-c3[c-]cccc3)nc(C#N)c2C)c(C)c1.[Ir] |
| InChI | InChI=1S/C20H18N3.Ir/c1-13-10-14(2)19(15(3)11-13)23-16(4)18(12-21)22-20(23)17-8-6-5-7-9-17;/h5-8,10-11H,1-4H3;/q-1; |
| InChIKey | MRWAIEVIBAOKCU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|