C41H34FIrN5-2 — CID 140604474
3-fluoro-6-(2,4,6-trimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 140604474) has the molecular formula C41H34FIrN5-2 and a molecular weight of 807.97 g/mol. Its IUPAC name is 3-fluoro-6-(2,4,6-trimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | 3-fluoro-6-(2,4,6-trimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 140604474 |
| Molecular Formula | C41H34FIrN5-2 |
| Molecular Weight | 807.97 g/mol |
| Exact Mass | 808.24 |
| IUPAC Name | 3-fluoro-6-(2,4,6-trimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(-c2nc3cc(F)c[c-]c3c3nc4ccccc4n23)c(C)c1.Cc1cc(C)c(-n2ccnc2-c2[c-]cccc2)c(C)c1.[Ir] |
| InChI | InChI=1S/C23H17FN3.C18H17N2.Ir/c1-13-10-14(2)21(15(3)11-13)23-26-19-12-16(24)8-9-17(19)22-25-18-6-4-5-7-20(18)27(22)23;1-13-11-14(2)17(15(3)12-13)20-10-9-19-18(20)16-7-5-4-6-8-16;/h4-8,10-12H,1-3H3;4-7,9-12H,1-3H3;/q2*-1; |
| InChIKey | AGFHWFZHSGJDPW-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.97 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|