C21H14IrN3- — CID 140604444
iridium;6-(2-methylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide (PubChem CID 140604444) has the molecular formula C21H14IrN3- and a molecular weight of 500.58 g/mol. Its IUPAC name is iridium;6-(2-methylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide.
| Compound Name | iridium;6-(2-methylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide |
|---|---|
| PubChem CID | 140604444 |
| Molecular Formula | C21H14IrN3- |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | iridium;6-(2-methylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide |
| SMILES | Cc1ccccc1-c1nc2ccc[c-]c2c2nc3ccccc3n12.[Ir] |
| InChI | InChI=1S/C21H14N3.Ir/c1-14-8-2-3-9-15(14)20-22-17-11-5-4-10-16(17)21-23-18-12-6-7-13-19(18)24(20)21;/h2-9,11-13H,1H3;/q-1; |
| InChIKey | ZYRMOTUWIUPJHU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|