C26H16IrN3- — CID 140604477
iridium;6-(2-phenylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide (PubChem CID 140604477) has the molecular formula C26H16IrN3- and a molecular weight of 562.65 g/mol. Its IUPAC name is iridium;6-(2-phenylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide.
| Compound Name | iridium;6-(2-phenylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide |
|---|---|
| PubChem CID | 140604477 |
| Molecular Formula | C26H16IrN3- |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | iridium;6-(2-phenylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide |
| SMILES | [Ir].[c-]1cccc2nc(-c3ccccc3-c3ccccc3)n3c4ccccc4nc3c12 |
| InChI | InChI=1S/C26H16N3.Ir/c1-2-10-18(11-3-1)19-12-4-5-13-20(19)25-27-22-15-7-6-14-21(22)26-28-23-16-8-9-17-24(23)29(25)26;/h1-13,15-17H;/q-1; |
| InChIKey | XXGUXHBLDHTPEB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|