C36H32IrN3O2- — CID 149303676
6-(2,6-dimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium (PubChem CID 149303676) has the molecular formula C36H32IrN3O2- and a molecular weight of 730.89 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium.
| Compound Name | 6-(2,6-dimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium |
|---|---|
| PubChem CID | 149303676 |
| Molecular Formula | C36H32IrN3O2- |
| Molecular Weight | 730.89 g/mol |
| Exact Mass | 731.21 |
| IUPAC Name | 6-(2,6-dimethylphenyl)-1H-benzimidazolo[1,2-c]quinazolin-1-ide;6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium |
| SMILES | C=Cc1ccc(CCC(O)=CC(C)=O)cc1.Cc1cccc(C)c1-c1nc2ccc[c-]c2c2nc3ccccc3n12.[Ir] |
| InChI | InChI=1S/C22H16N3.C14H16O2.Ir/c1-14-8-7-9-15(2)20(14)22-23-17-11-4-3-10-16(17)21-24-18-12-5-6-13-19(18)25(21)22;1-3-12-4-6-13(7-5-12)8-9-14(16)10-11(2)15;/h3-9,11-13H,1-2H3;3-7,10,16H,1,8-9H2,2H3;/q-1;; |
| InChIKey | BNJNFGOTPIYBAF-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.89 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|