C15H13ClN2 — CID 117250780
1-chloro-5-methyl-3-(2-methylphenyl)imidazo[1,5-a]pyridine (PubChem CID 117250780) has the molecular formula C15H13ClN2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 1-chloro-5-methyl-3-(2-methylphenyl)imidazo[1,5-a]pyridine.
| Compound Name | 1-chloro-5-methyl-3-(2-methylphenyl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117250780 |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-chloro-5-methyl-3-(2-methylphenyl)imidazo[1,5-a]pyridine |
| SMILES | Cc1ccccc1-c1nc(Cl)c2cccc(C)n12 |
| InChI | InChI=1S/C15H13ClN2/c1-10-6-3-4-8-12(10)15-17-14(16)13-9-5-7-11(2)18(13)15/h3-9H,1-2H3 |
| InChIKey | HKZCKWWSANCALQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |