C39H39IrN3-2 — CID 140820138
CID 140820138 (PubChem CID 140820138) has the molecular formula C39H39IrN3-2 and a molecular weight of 741.98 g/mol.
| Compound Name | CID 140820138 |
|---|---|
| PubChem CID | 140820138 |
| Molecular Formula | C39H39IrN3-2 |
| Molecular Weight | 741.98 g/mol |
| Exact Mass | 742.28 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-n2ccnc2-c2[c-]cccc2)c(C)c1.Cc1cc2c3c(cnc2c2[c-]cccc12)C(C)(C)CC3(C)C.[Ir] |
| InChI | InChI=1S/C21H22N.C18H17N2.Ir/c1-13-10-16-18-17(20(2,3)12-21(18,4)5)11-22-19(16)15-9-7-6-8-14(13)15;1-13-11-14(2)17(15(3)12-13)20-10-9-19-18(20)16-7-5-4-6-8-16;/h6-8,10-11H,12H2,1-5H3;4-7,9-12H,1-3H3;/q2*-1; |
| InChIKey | GCDRHSBSHBYOKZ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.98 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|