C19H17NO3 — CID 2303816
(3R)-2,2-dimethyl-3-quinolin-2-yl-1,4-benzodioxin-3-ol (PubChem CID 2303816) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-3-quinolin-2-yl-1,4-benzodioxin-3-ol.
| Compound Name | (3R)-2,2-dimethyl-3-quinolin-2-yl-1,4-benzodioxin-3-ol |
|---|---|
| PubChem CID | 2303816 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3R)-2,2-dimethyl-3-quinolin-2-yl-1,4-benzodioxin-3-ol |
| SMILES | CC1(C)Oc2ccccc2O[C@]1(O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H17NO3/c1-18(2)19(21,23-16-10-6-5-9-15(16)22-18)17-12-11-13-7-3-4-8-14(13)20-17/h3-12,21H,1-2H3/t19-/m1/s1 |
| InChIKey | BRSRMBIRKVDRSC-LJQANCHMSA-N |
| XLogP | 3.63 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |