About 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol
9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171956202) has the molecular formula C17H19NO2S
and a molecular weight of 301.41 g/mol. Its IUPAC name is 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 171956202 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1C2CCCC1CC(O)(c1ccc3ccccc3n1)C2 |
| InChI | InChI=1S/C17H19NO2S/c19-17(10-13-5-3-6-14(11-17)21(13)20)16-9-8-12-4-1-2-7-15(12)18-16/h1-2,4,7-9,13-14,19H,3,5-6,10-11H2 |
| InChIKey | UBKKFIQXHWROSE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol (CID 171956202) is 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol is O=S1C2CCCC1CC(O)(c1ccc3ccccc3n1)C2.
What is the InChIKey of 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The InChIKey is UBKKFIQXHWROSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2S/c19-17(10-13-5-3-6-14(11-17)21(13)20)16-9-8-12-4-1-2-7-15(12)18-16/h1-2,4,7-9,13-14,19H,3,5-6,10-11H2.
What are the key properties of 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol has a molecular weight of 301.41 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxo-3-quinolin-2-yl-9λ4-thiabicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 171956202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).