About 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol
3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171953234) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 171953234 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1C2CCCC1CC(O)(C1CC1)C2 |
| InChI | InChI=1S/C11H18O2S/c12-11(8-4-5-8)6-9-2-1-3-10(7-11)14(9)13/h8-10,12H,1-7H2 |
| InChIKey | PWBFDZIZOPRBLD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (CID 171953234) is 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol is O=S1C2CCCC1CC(O)(C1CC1)C2.
What is the InChIKey of 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The InChIKey is PWBFDZIZOPRBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2S/c12-11(8-4-5-8)6-9-2-1-3-10(7-11)14(9)13/h8-10,12H,1-7H2.
What are the key properties of 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol has a molecular weight of 214.33 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 171953234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).