C15H16N2O3S — CID 171956391
8,8-dioxo-3-quinoxalin-2-yl-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171956391) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 8,8-dioxo-3-quinoxalin-2-yl-8λ6-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8,8-dioxo-3-quinoxalin-2-yl-8λ6-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171956391 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 8,8-dioxo-3-quinoxalin-2-yl-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)C2CCC1CC(O)(c1cnc3ccccc3n1)C2 |
| InChI | InChI=1S/C15H16N2O3S/c18-15(7-10-5-6-11(8-15)21(10,19)20)14-9-16-12-3-1-2-4-13(12)17-14/h1-4,9-11,18H,5-8H2 |
| InChIKey | AAEHNBAFYYFSBO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |