C16H14N2O — CID 87672269
(5Z,7Z,9Z,11Z,13Z)-2-oxa-3,4-diazabicyclo[13.4.0]nonadeca-1(19),3,5,7,9,11,13,15,17-nonaene (PubChem CID 87672269) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is (5Z,7Z,9Z,11Z,13Z)-2-oxa-3,4-diazabicyclo[13.4.0]nonadeca-1(19),3,5,7,9,11,13,15,17-nonaene.
| Compound Name | (5Z,7Z,9Z,11Z,13Z)-2-oxa-3,4-diazabicyclo[13.4.0]nonadeca-1(19),3,5,7,9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 87672269 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (5Z,7Z,9Z,11Z,13Z)-2-oxa-3,4-diazabicyclo[13.4.0]nonadeca-1(19),3,5,7,9,11,13,15,17-nonaene |
| SMILES | C1=C\C=C/C=C\c2ccccc2O/N=N\C=C\C=C/1 |
| InChI | InChI=1S/C16H14N2O/c1-2-4-6-10-14-17-18-19-16-13-9-8-12-15(16)11-7-5-3-1/h1-14H/b2-1-,5-3-,6-4-,11-7-,14-10-,18-17- |
| InChIKey | VITMZKVKJINTGL-RZAWYEEZSA-N |
| XLogP | 4.64 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |