C13H11NO5 — CID 70619135
1,2-benzoxazepine;but-2-enedioic acid (PubChem CID 70619135) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 1,2-benzoxazepine;but-2-enedioic acid.
| Compound Name | 1,2-benzoxazepine;but-2-enedioic acid |
|---|---|
| PubChem CID | 70619135 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1,2-benzoxazepine;but-2-enedioic acid |
| SMILES | C1=Cc2ccccc2ON=C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C9H7NO.C4H4O4/c1-2-6-9-8(4-1)5-3-7-10-11-9;5-3(6)1-2-4(7)8/h1-7H;1-2H,(H,5,6)(H,7,8) |
| InChIKey | BARLPBPUTCZWPM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|