C9H8NO+ — CID 173001154
1,2-benzoxazepin-2-ium (PubChem CID 173001154) has the molecular formula C9H8NO+ and a molecular weight of 146.17 g/mol. Its IUPAC name is 1,2-benzoxazepin-2-ium.
| Compound Name | 1,2-benzoxazepin-2-ium |
|---|---|
| PubChem CID | 173001154 |
| Molecular Formula | C9H8NO+ |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1,2-benzoxazepin-2-ium |
| SMILES | C1=Cc2ccccc2O[NH+]=C1 |
| InChI | InChI=1S/C9H7NO/c1-2-6-9-8(4-1)5-3-7-10-11-9/h1-7H/p+1 |
| InChIKey | ZCXLTWVZYXBHJS-UHFFFAOYSA-O |
| XLogP | 0.16 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |