C10H12 — CID 139752949
(1Z,3Z,5Z,7Z)-1,3-dimethylcycloocta-1,3,5,7-tetraene (PubChem CID 139752949) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-1,3-dimethylcycloocta-1,3,5,7-tetraene.
| Compound Name | (1Z,3Z,5Z,7Z)-1,3-dimethylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 139752949 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-1,3-dimethylcycloocta-1,3,5,7-tetraene |
| SMILES | CC1=C/C=C\C=C/C(C)=C\1 |
| InChI | InChI=1S/C10H12/c1-9-6-4-3-5-7-10(2)8-9/h3-8H,1-2H3/b4-3-,5-3-,6-4-,7-5-,9-6-,9-8-,10-7-,10-8- |
| InChIKey | ICDUXQPZSXPGKE-DELHAVTCSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |